C14H15ClN4O2S — CID 23478660
N-tert-butyl-6-(4-chlorophenyl)sulfanyl-5-nitropyrimidin-4-amine (PubChem CID 23478660) has the molecular formula C14H15ClN4O2S and a molecular weight of 338.82 g/mol. Its IUPAC name is N-tert-butyl-6-(4-chlorophenyl)sulfanyl-5-nitropyrimidin-4-amine.
| Compound Name | N-tert-butyl-6-(4-chlorophenyl)sulfanyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23478660 |
| Molecular Formula | C14H15ClN4O2S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N-tert-butyl-6-(4-chlorophenyl)sulfanyl-5-nitropyrimidin-4-amine |
| SMILES | CC(C)(C)Nc1ncnc(Sc2ccc(Cl)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15ClN4O2S/c1-14(2,3)18-12-11(19(20)21)13(17-8-16-12)22-10-6-4-9(15)5-7-10/h4-8H,1-3H3,(H,16,17,18) |
| InChIKey | ZIJCPHRDQSIHSU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|