C16H13N3O2S — CID 40650984
N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 40650984) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 40650984 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | N-[(Z)-2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | C(=N\Nc1nc2ccccc2s1)\c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H13N3O2S/c1-2-4-15-12(3-1)18-16(22-15)19-17-10-11-5-6-13-14(9-11)21-8-7-20-13/h1-6,9-10H,7-8H2,(H,18,19)/b17-10- |
| InChIKey | YVZLGFOYBBCJQE-YVLHZVERSA-N |
| XLogP | 3.51 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|