C14H9Cl2FN2OS — CID 107575961
N-(3,5-dichloro-4-fluorophenyl)-6-methoxy-1,3-benzothiazol-2-amine (PubChem CID 107575961) has the molecular formula C14H9Cl2FN2OS and a molecular weight of 343.21 g/mol. Its IUPAC name is N-(3,5-dichloro-4-fluorophenyl)-6-methoxy-1,3-benzothiazol-2-amine.
| Compound Name | N-(3,5-dichloro-4-fluorophenyl)-6-methoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 107575961 |
| Molecular Formula | C14H9Cl2FN2OS |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | N-(3,5-dichloro-4-fluorophenyl)-6-methoxy-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc2nc(Nc3cc(Cl)c(F)c(Cl)c3)sc2c1 |
| InChI | InChI=1S/C14H9Cl2FN2OS/c1-20-8-2-3-11-12(6-8)21-14(19-11)18-7-4-9(15)13(17)10(16)5-7/h2-6H,1H3,(H,18,19) |
| InChIKey | RJLHFTFZERQLCM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|