C11H13NS2 — CID 116999846
3-(2-methyl-1,3-benzothiazol-6-yl)propane-1-thiol (PubChem CID 116999846) has the molecular formula C11H13NS2 and a molecular weight of 223.37 g/mol. Its IUPAC name is 3-(2-methyl-1,3-benzothiazol-6-yl)propane-1-thiol.
| Compound Name | 3-(2-methyl-1,3-benzothiazol-6-yl)propane-1-thiol |
|---|---|
| PubChem CID | 116999846 |
| Molecular Formula | C11H13NS2 |
| Molecular Weight | 223.37 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 3-(2-methyl-1,3-benzothiazol-6-yl)propane-1-thiol |
| SMILES | Cc1nc2ccc(CCCS)cc2s1 |
| InChI | InChI=1S/C11H13NS2/c1-8-12-10-5-4-9(3-2-6-13)7-11(10)14-8/h4-5,7,13H,2-3,6H2,1H3 |
| InChIKey | OHLGPVRAXNRWJW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|