C12H16N2S — CID 116999819
N-ethyl-2-(2-methyl-1,3-benzothiazol-6-yl)ethanamine (PubChem CID 116999819) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is N-ethyl-2-(2-methyl-1,3-benzothiazol-6-yl)ethanamine.
| Compound Name | N-ethyl-2-(2-methyl-1,3-benzothiazol-6-yl)ethanamine |
|---|---|
| PubChem CID | 116999819 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N-ethyl-2-(2-methyl-1,3-benzothiazol-6-yl)ethanamine |
| SMILES | CCNCCc1ccc2nc(C)sc2c1 |
| InChI | InChI=1S/C12H16N2S/c1-3-13-7-6-10-4-5-11-12(8-10)15-9(2)14-11/h4-5,8,13H,3,6-7H2,1-2H3 |
| InChIKey | YLYSMLMEUCBOOA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|