C14H27N — CID 145215034
2-(3,4-dimethylphenyl)-N-ethylethanamine;ethane;molecular hydrogen (PubChem CID 145215034) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-N-ethylethanamine;ethane;molecular hydrogen.
| Compound Name | 2-(3,4-dimethylphenyl)-N-ethylethanamine;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 145215034 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-N-ethylethanamine;ethane;molecular hydrogen |
| SMILES | CC.CCNCCc1ccc(C)c(C)c1.[H][H] |
| InChI | InChI=1S/C12H19N.C2H6.H2/c1-4-13-8-7-12-6-5-10(2)11(3)9-12;1-2;/h5-6,9,13H,4,7-8H2,1-3H3;1-2H3;1H |
| InChIKey | XUEDRRVOCGDAGO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|