About 2-[1-[2-(3,4-dimethylphenyl)ethyl]cyclopentyl]-N-ethylethanamine
2-[1-[2-(3,4-dimethylphenyl)ethyl]cyclopentyl]-N-ethylethanamine (PubChem CID 65303868) has the molecular formula C19H31N
and a molecular weight of 273.46 g/mol. Its IUPAC name is 2-[1-[2-(3,4-dimethylphenyl)ethyl]cyclopentyl]-N-ethylethanamine.
Molecular Properties
| Compound Name | 2-[1-[2-(3,4-dimethylphenyl)ethyl]cyclopentyl]-N-ethylethanamine |
| PubChem CID | 65303868 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | 2-[1-[2-(3,4-dimethylphenyl)ethyl]cyclopentyl]-N-ethylethanamine |
| SMILES | CCNCCC1(CCc2ccc(C)c(C)c2)CCCC1 |
| InChI | InChI=1S/C19H31N/c1-4-20-14-13-19(10-5-6-11-19)12-9-18-8-7-16(2)17(3)15-18/h7-8,15,20H,4-6,9-14H2,1-3H3 |
| InChIKey | CWHALMGEDDLCJQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[2-(3,4-dimethylphenyl)ethyl]cyclopentyl]-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[2-(3,4-dimethylphenyl)ethyl]cyclopentyl]-N-ethylethanamine?
The IUPAC name of 2-[1-[2-(3,4-dimethylphenyl)ethyl]cyclopentyl]-N-ethylethanamine (CID 65303868) is 2-[1-[2-(3,4-dimethylphenyl)ethyl]cyclopentyl]-N-ethylethanamine.
What is the SMILES notation for 2-[1-[2-(3,4-dimethylphenyl)ethyl]cyclopentyl]-N-ethylethanamine?
The canonical SMILES for 2-[1-[2-(3,4-dimethylphenyl)ethyl]cyclopentyl]-N-ethylethanamine is CCNCCC1(CCc2ccc(C)c(C)c2)CCCC1.
What is the InChIKey of 2-[1-[2-(3,4-dimethylphenyl)ethyl]cyclopentyl]-N-ethylethanamine?
The InChIKey is CWHALMGEDDLCJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31N/c1-4-20-14-13-19(10-5-6-11-19)12-9-18-8-7-16(2)17(3)15-18/h7-8,15,20H,4-6,9-14H2,1-3H3.
What are the key properties of 2-[1-[2-(3,4-dimethylphenyl)ethyl]cyclopentyl]-N-ethylethanamine?
2-[1-[2-(3,4-dimethylphenyl)ethyl]cyclopentyl]-N-ethylethanamine has a molecular weight of 273.46 g/mol, XLogP of 4.80, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[2-(3,4-dimethylphenyl)ethyl]cyclopentyl]-N-ethylethanamine is sourced from PubChem (CID 65303868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).