C15H22N2OS — CID 145100782
ethane;4-[(2-methyl-1,3-benzothiazol-6-yl)methyl]morpholine (PubChem CID 145100782) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is ethane;4-[(2-methyl-1,3-benzothiazol-6-yl)methyl]morpholine.
| Compound Name | ethane;4-[(2-methyl-1,3-benzothiazol-6-yl)methyl]morpholine |
|---|---|
| PubChem CID | 145100782 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | ethane;4-[(2-methyl-1,3-benzothiazol-6-yl)methyl]morpholine |
| SMILES | CC.Cc1nc2ccc(CN3CCOCC3)cc2s1 |
| InChI | InChI=1S/C13H16N2OS.C2H6/c1-10-14-12-3-2-11(8-13(12)17-10)9-15-4-6-16-7-5-15;1-2/h2-3,8H,4-7,9H2,1H3;1-2H3 |
| InChIKey | BUJKYUFUKKFPHG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |