C19H25N3O2S — CID 108763394
N-[6-(morpholin-4-ylmethyl)-1,3-benzothiazol-2-yl]cyclohexanecarboxamide (PubChem CID 108763394) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is N-[6-(morpholin-4-ylmethyl)-1,3-benzothiazol-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[6-(morpholin-4-ylmethyl)-1,3-benzothiazol-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 108763394 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-[6-(morpholin-4-ylmethyl)-1,3-benzothiazol-2-yl]cyclohexanecarboxamide |
| SMILES | O=C(Nc1nc2ccc(CN3CCOCC3)cc2s1)C1CCCCC1 |
| InChI | InChI=1S/C19H25N3O2S/c23-18(15-4-2-1-3-5-15)21-19-20-16-7-6-14(12-17(16)25-19)13-22-8-10-24-11-9-22/h6-7,12,15H,1-5,8-11,13H2,(H,20,21,23) |
| InChIKey | UFJGVLNMOQJDDJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |