C15H18ClN3O3S — CID 108740850
2-chloroethyl N-[6-(morpholin-4-ylmethyl)-1,3-benzothiazol-2-yl]carbamate (PubChem CID 108740850) has the molecular formula C15H18ClN3O3S and a molecular weight of 355.85 g/mol. Its IUPAC name is 2-chloroethyl N-[6-(morpholin-4-ylmethyl)-1,3-benzothiazol-2-yl]carbamate.
| Compound Name | 2-chloroethyl N-[6-(morpholin-4-ylmethyl)-1,3-benzothiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 108740850 |
| Molecular Formula | C15H18ClN3O3S |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-chloroethyl N-[6-(morpholin-4-ylmethyl)-1,3-benzothiazol-2-yl]carbamate |
| SMILES | O=C(Nc1nc2ccc(CN3CCOCC3)cc2s1)OCCCl |
| InChI | InChI=1S/C15H18ClN3O3S/c16-3-6-22-15(20)18-14-17-12-2-1-11(9-13(12)23-14)10-19-4-7-21-8-5-19/h1-2,9H,3-8,10H2,(H,17,18,20) |
| InChIKey | MMYOBLZPENCKJK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|