C22H25N3O5S — CID 108763385
3,4,5-trimethoxy-N-[6-(morpholin-4-ylmethyl)-1,3-benzothiazol-2-yl]benzamide (PubChem CID 108763385) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[6-(morpholin-4-ylmethyl)-1,3-benzothiazol-2-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[6-(morpholin-4-ylmethyl)-1,3-benzothiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 108763385 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 3,4,5-trimethoxy-N-[6-(morpholin-4-ylmethyl)-1,3-benzothiazol-2-yl]benzamide |
| SMILES | COc1cc(C(=O)Nc2nc3ccc(CN4CCOCC4)cc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C22H25N3O5S/c1-27-17-11-15(12-18(28-2)20(17)29-3)21(26)24-22-23-16-5-4-14(10-19(16)31-22)13-25-6-8-30-9-7-25/h4-5,10-12H,6-9,13H2,1-3H3,(H,23,24,26) |
| InChIKey | WJLIULUPFZYHCP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |