C14H19N3S — CID 120845998
(3R)-1-[(2-methyl-1,3-benzothiazol-6-yl)methyl]piperidin-3-amine (PubChem CID 120845998) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is (3R)-1-[(2-methyl-1,3-benzothiazol-6-yl)methyl]piperidin-3-amine.
| Compound Name | (3R)-1-[(2-methyl-1,3-benzothiazol-6-yl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 120845998 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | (3R)-1-[(2-methyl-1,3-benzothiazol-6-yl)methyl]piperidin-3-amine |
| SMILES | Cc1nc2ccc(CN3CCC[C@@H](N)C3)cc2s1 |
| InChI | InChI=1S/C14H19N3S/c1-10-16-13-5-4-11(7-14(13)18-10)8-17-6-2-3-12(15)9-17/h4-5,7,12H,2-3,6,8-9,15H2,1H3/t12-/m1/s1 |
| InChIKey | WODDZWHCPNEUCX-GFCCVEGCSA-N |
| XLogP | 2.53 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |