C14H19N3OS — CID 120845980
(3R)-1-[(6-methoxy-1,3-benzothiazol-2-yl)methyl]piperidin-3-amine (PubChem CID 120845980) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is (3R)-1-[(6-methoxy-1,3-benzothiazol-2-yl)methyl]piperidin-3-amine.
| Compound Name | (3R)-1-[(6-methoxy-1,3-benzothiazol-2-yl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 120845980 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (3R)-1-[(6-methoxy-1,3-benzothiazol-2-yl)methyl]piperidin-3-amine |
| SMILES | COc1ccc2nc(CN3CCC[C@@H](N)C3)sc2c1 |
| InChI | InChI=1S/C14H19N3OS/c1-18-11-4-5-12-13(7-11)19-14(16-12)9-17-6-2-3-10(15)8-17/h4-5,7,10H,2-3,6,8-9,15H2,1H3/t10-/m1/s1 |
| InChIKey | FUSHUCGAVJOGKU-SNVBAGLBSA-N |
| XLogP | 2.23 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |