C16H22ClN3S — CID 120844245
2-[(2-methyl-1,3-benzothiazol-6-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine;hydrochloride (PubChem CID 120844245) has the molecular formula C16H22ClN3S and a molecular weight of 323.89 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-benzothiazol-6-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine;hydrochloride.
| Compound Name | 2-[(2-methyl-1,3-benzothiazol-6-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120844245 |
| Molecular Formula | C16H22ClN3S |
| Molecular Weight | 323.89 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-[(2-methyl-1,3-benzothiazol-6-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine;hydrochloride |
| SMILES | Cc1nc2ccc(CN3CC4CCC(N)C4C3)cc2s1.Cl |
| InChI | InChI=1S/C16H21N3S.ClH/c1-10-18-15-5-2-11(6-16(15)20-10)7-19-8-12-3-4-14(17)13(12)9-19;/h2,5-6,12-14H,3-4,7-9,17H2,1H3;1H |
| InChIKey | WECVCKZMKAKDEO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.89 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |