C15H21N5S — CID 79954961
4,4-dimethyl-N-[3-methyl-4-(tetrazol-1-yl)phenyl]thian-3-amine (PubChem CID 79954961) has the molecular formula C15H21N5S and a molecular weight of 303.44 g/mol. Its IUPAC name is 4,4-dimethyl-N-[3-methyl-4-(tetrazol-1-yl)phenyl]thian-3-amine.
| Compound Name | 4,4-dimethyl-N-[3-methyl-4-(tetrazol-1-yl)phenyl]thian-3-amine |
|---|---|
| PubChem CID | 79954961 |
| Molecular Formula | C15H21N5S |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 4,4-dimethyl-N-[3-methyl-4-(tetrazol-1-yl)phenyl]thian-3-amine |
| SMILES | Cc1cc(NC2CSCCC2(C)C)ccc1-n1cnnn1 |
| InChI | InChI=1S/C15H21N5S/c1-11-8-12(4-5-13(11)20-10-16-18-19-20)17-14-9-21-7-6-15(14,2)3/h4-5,8,10,14,17H,6-7,9H2,1-3H3 |
| InChIKey | UATVBCUCDVKDGH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |