C16H25NO2S — CID 79948684
N-(3-ethoxy-4-methoxyphenyl)-4,4-dimethylthian-3-amine (PubChem CID 79948684) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is N-(3-ethoxy-4-methoxyphenyl)-4,4-dimethylthian-3-amine.
| Compound Name | N-(3-ethoxy-4-methoxyphenyl)-4,4-dimethylthian-3-amine |
|---|---|
| PubChem CID | 79948684 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-(3-ethoxy-4-methoxyphenyl)-4,4-dimethylthian-3-amine |
| SMILES | CCOc1cc(NC2CSCCC2(C)C)ccc1OC |
| InChI | InChI=1S/C16H25NO2S/c1-5-19-14-10-12(6-7-13(14)18-4)17-15-11-20-9-8-16(15,2)3/h6-7,10,15,17H,5,8-9,11H2,1-4H3 |
| InChIKey | AZUPGVCGJKISON-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|