C15H22N2OS — CID 79951402
N-[3-[(4,4-dimethylthian-3-yl)amino]phenyl]acetamide (PubChem CID 79951402) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is N-[3-[(4,4-dimethylthian-3-yl)amino]phenyl]acetamide.
| Compound Name | N-[3-[(4,4-dimethylthian-3-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 79951402 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N-[3-[(4,4-dimethylthian-3-yl)amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NC2CSCCC2(C)C)c1 |
| InChI | InChI=1S/C15H22N2OS/c1-11(18)16-12-5-4-6-13(9-12)17-14-10-19-8-7-15(14,2)3/h4-6,9,14,17H,7-8,10H2,1-3H3,(H,16,18) |
| InChIKey | SBJWOTQYFHUNDV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |