C15H22N2O2S — CID 79947927
2-[3-[(4,4-dimethylthian-3-yl)amino]phenoxy]acetamide (PubChem CID 79947927) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-[3-[(4,4-dimethylthian-3-yl)amino]phenoxy]acetamide.
| Compound Name | 2-[3-[(4,4-dimethylthian-3-yl)amino]phenoxy]acetamide |
|---|---|
| PubChem CID | 79947927 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-[3-[(4,4-dimethylthian-3-yl)amino]phenoxy]acetamide |
| SMILES | CC1(C)CCSCC1Nc1cccc(OCC(N)=O)c1 |
| InChI | InChI=1S/C15H22N2O2S/c1-15(2)6-7-20-10-13(15)17-11-4-3-5-12(8-11)19-9-14(16)18/h3-5,8,13,17H,6-7,9-10H2,1-2H3,(H2,16,18) |
| InChIKey | DYRJNHUYAZIUFR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |