About 2-chloro-5-[(4,4-dimethylthian-3-yl)amino]-N,N-dimethylbenzamide
2-chloro-5-[(4,4-dimethylthian-3-yl)amino]-N,N-dimethylbenzamide (PubChem CID 79954819) has the molecular formula C16H23ClN2OS
and a molecular weight of 326.89 g/mol. Its IUPAC name is 2-chloro-5-[(4,4-dimethylthian-3-yl)amino]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 2-chloro-5-[(4,4-dimethylthian-3-yl)amino]-N,N-dimethylbenzamide |
| PubChem CID | 79954819 |
| Molecular Formula | C16H23ClN2OS |
| Molecular Weight | 326.89 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-chloro-5-[(4,4-dimethylthian-3-yl)amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cc(NC2CSCCC2(C)C)ccc1Cl |
| InChI | InChI=1S/C16H23ClN2OS/c1-16(2)7-8-21-10-14(16)18-11-5-6-13(17)12(9-11)15(20)19(3)4/h5-6,9,14,18H,7-8,10H2,1-4H3 |
| InChIKey | HRIOQYPISFFUET-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.89 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-5-[(4,4-dimethylthian-3-yl)amino]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-[(4,4-dimethylthian-3-yl)amino]-N,N-dimethylbenzamide?
The IUPAC name of 2-chloro-5-[(4,4-dimethylthian-3-yl)amino]-N,N-dimethylbenzamide (CID 79954819) is 2-chloro-5-[(4,4-dimethylthian-3-yl)amino]-N,N-dimethylbenzamide.
What is the SMILES notation for 2-chloro-5-[(4,4-dimethylthian-3-yl)amino]-N,N-dimethylbenzamide?
The canonical SMILES for 2-chloro-5-[(4,4-dimethylthian-3-yl)amino]-N,N-dimethylbenzamide is CN(C)C(=O)c1cc(NC2CSCCC2(C)C)ccc1Cl.
What is the InChIKey of 2-chloro-5-[(4,4-dimethylthian-3-yl)amino]-N,N-dimethylbenzamide?
The InChIKey is HRIOQYPISFFUET-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23ClN2OS/c1-16(2)7-8-21-10-14(16)18-11-5-6-13(17)12(9-11)15(20)19(3)4/h5-6,9,14,18H,7-8,10H2,1-4H3.
What are the key properties of 2-chloro-5-[(4,4-dimethylthian-3-yl)amino]-N,N-dimethylbenzamide?
2-chloro-5-[(4,4-dimethylthian-3-yl)amino]-N,N-dimethylbenzamide has a molecular weight of 326.89 g/mol, XLogP of 3.99, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-[(4,4-dimethylthian-3-yl)amino]-N,N-dimethylbenzamide is sourced from PubChem (CID 79954819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).