C15H21ClN2OS — CID 79957292
2-chloro-N,N-dimethyl-5-[(2-methylthian-3-yl)amino]benzamide (PubChem CID 79957292) has the molecular formula C15H21ClN2OS and a molecular weight of 312.87 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-5-[(2-methylthian-3-yl)amino]benzamide.
| Compound Name | 2-chloro-N,N-dimethyl-5-[(2-methylthian-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 79957292 |
| Molecular Formula | C15H21ClN2OS |
| Molecular Weight | 312.87 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-chloro-N,N-dimethyl-5-[(2-methylthian-3-yl)amino]benzamide |
| SMILES | CC1SCCCC1Nc1ccc(Cl)c(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H21ClN2OS/c1-10-14(5-4-8-20-10)17-11-6-7-13(16)12(9-11)15(19)18(2)3/h6-7,9-10,14,17H,4-5,8H2,1-3H3 |
| InChIKey | YEIMZTBTINUKMD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.87 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |