C14H20ClN3O — CID 79461229
5-[(3-aminocyclopentyl)amino]-2-chloro-N,N-dimethylbenzamide (PubChem CID 79461229) has the molecular formula C14H20ClN3O and a molecular weight of 281.79 g/mol. Its IUPAC name is 5-[(3-aminocyclopentyl)amino]-2-chloro-N,N-dimethylbenzamide.
| Compound Name | 5-[(3-aminocyclopentyl)amino]-2-chloro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 79461229 |
| Molecular Formula | C14H20ClN3O |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 5-[(3-aminocyclopentyl)amino]-2-chloro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cc(NC2CCC(N)C2)ccc1Cl |
| InChI | InChI=1S/C14H20ClN3O/c1-18(2)14(19)12-8-11(5-6-13(12)15)17-10-4-3-9(16)7-10/h5-6,8-10,17H,3-4,7,16H2,1-2H3 |
| InChIKey | ZERRTCKUQHHBQU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |