C15H21ClN2O — CID 65044373
2-chloro-N,N-dimethyl-5-[(2-methylcyclopentyl)amino]benzamide (PubChem CID 65044373) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-5-[(2-methylcyclopentyl)amino]benzamide.
| Compound Name | 2-chloro-N,N-dimethyl-5-[(2-methylcyclopentyl)amino]benzamide |
|---|---|
| PubChem CID | 65044373 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 2-chloro-N,N-dimethyl-5-[(2-methylcyclopentyl)amino]benzamide |
| SMILES | CC1CCCC1Nc1ccc(Cl)c(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H21ClN2O/c1-10-5-4-6-14(10)17-11-7-8-13(16)12(9-11)15(19)18(2)3/h7-10,14,17H,4-6H2,1-3H3 |
| InChIKey | OWFSRJCFSXEITJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |