C15H20ClNO2 — CID 64761654
2-chloro-5-[(2,3-dimethylcyclohexyl)amino]benzoic acid (PubChem CID 64761654) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is 2-chloro-5-[(2,3-dimethylcyclohexyl)amino]benzoic acid.
| Compound Name | 2-chloro-5-[(2,3-dimethylcyclohexyl)amino]benzoic acid |
|---|---|
| PubChem CID | 64761654 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-chloro-5-[(2,3-dimethylcyclohexyl)amino]benzoic acid |
| SMILES | CC1CCCC(Nc2ccc(Cl)c(C(=O)O)c2)C1C |
| InChI | InChI=1S/C15H20ClNO2/c1-9-4-3-5-14(10(9)2)17-11-6-7-13(16)12(8-11)15(18)19/h6-10,14,17H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | PJTNEPICNLROSV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |