C14H21N3O — CID 79461660
3-[(3-aminocyclopentyl)amino]-N,N-dimethylbenzamide (PubChem CID 79461660) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 3-[(3-aminocyclopentyl)amino]-N,N-dimethylbenzamide.
| Compound Name | 3-[(3-aminocyclopentyl)amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 79461660 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 3-[(3-aminocyclopentyl)amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(NC2CCC(N)C2)c1 |
| InChI | InChI=1S/C14H21N3O/c1-17(2)14(18)10-4-3-5-12(8-10)16-13-7-6-11(15)9-13/h3-5,8,11,13,16H,6-7,9,15H2,1-2H3 |
| InChIKey | QOWYANQOQZOEGA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |