C16H25N3O2 — CID 107239958
tert-butyl N-[3-[(3-aminocyclopentyl)amino]phenyl]carbamate (PubChem CID 107239958) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is tert-butyl N-[3-[(3-aminocyclopentyl)amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(3-aminocyclopentyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 107239958 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | tert-butyl N-[3-[(3-aminocyclopentyl)amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(NC2CCC(N)C2)c1 |
| InChI | InChI=1S/C16H25N3O2/c1-16(2,3)21-15(20)19-13-6-4-5-12(10-13)18-14-8-7-11(17)9-14/h4-6,10-11,14,18H,7-9,17H2,1-3H3,(H,19,20) |
| InChIKey | CQLIKOOPLBZXHJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |