C18H28N2O2 — CID 107239831
tert-butyl N-[3-[(3,3-dimethylcyclopentyl)amino]phenyl]carbamate (PubChem CID 107239831) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is tert-butyl N-[3-[(3,3-dimethylcyclopentyl)amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(3,3-dimethylcyclopentyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 107239831 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | tert-butyl N-[3-[(3,3-dimethylcyclopentyl)amino]phenyl]carbamate |
| SMILES | CC1(C)CCC(Nc2cccc(NC(=O)OC(C)(C)C)c2)C1 |
| InChI | InChI=1S/C18H28N2O2/c1-17(2,3)22-16(21)20-14-8-6-7-13(11-14)19-15-9-10-18(4,5)12-15/h6-8,11,15,19H,9-10,12H2,1-5H3,(H,20,21) |
| InChIKey | FCYLOJHPUAAJJH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |