C18H29N3O2 — CID 107243151
tert-butyl N-[5-[(4,4-dimethylcyclohexyl)amino]-2-pyridinyl]carbamate (PubChem CID 107243151) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is tert-butyl N-[5-[(4,4-dimethylcyclohexyl)amino]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-[(4,4-dimethylcyclohexyl)amino]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 107243151 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | tert-butyl N-[5-[(4,4-dimethylcyclohexyl)amino]-2-pyridinyl]carbamate |
| SMILES | CC1(C)CCC(Nc2ccc(NC(=O)OC(C)(C)C)nc2)CC1 |
| InChI | InChI=1S/C18H29N3O2/c1-17(2,3)23-16(22)21-15-7-6-14(12-19-15)20-13-8-10-18(4,5)11-9-13/h6-7,12-13,20H,8-11H2,1-5H3,(H,19,21,22) |
| InChIKey | NZNIWSUDBRWAQW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |