C16H25N3O3 — CID 103933766
tert-butyl N-[5-[(2-methyloxan-4-yl)amino]-2-pyridinyl]carbamate (PubChem CID 103933766) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is tert-butyl N-[5-[(2-methyloxan-4-yl)amino]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-[(2-methyloxan-4-yl)amino]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 103933766 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | tert-butyl N-[5-[(2-methyloxan-4-yl)amino]-2-pyridinyl]carbamate |
| SMILES | CC1CC(Nc2ccc(NC(=O)OC(C)(C)C)nc2)CCO1 |
| InChI | InChI=1S/C16H25N3O3/c1-11-9-12(7-8-21-11)18-13-5-6-14(17-10-13)19-15(20)22-16(2,3)4/h5-6,10-12,18H,7-9H2,1-4H3,(H,17,19,20) |
| InChIKey | XNIOEEBWXKSCRI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |