C16H23N3O4 — CID 163891937
tert-butyl N-[3-[(1-oxido-2-oxopiperidin-1-ium-3-yl)amino]phenyl]carbamate (PubChem CID 163891937) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is tert-butyl N-[3-[(1-oxido-2-oxopiperidin-1-ium-3-yl)amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(1-oxido-2-oxopiperidin-1-ium-3-yl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 163891937 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | tert-butyl N-[3-[(1-oxido-2-oxopiperidin-1-ium-3-yl)amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(NC2CCC[NH+]([O-])C2=O)c1 |
| InChI | InChI=1S/C16H23N3O4/c1-16(2,3)23-15(21)18-12-7-4-6-11(10-12)17-13-8-5-9-19(22)14(13)20/h4,6-7,10,13,17,19H,5,8-9H2,1-3H3,(H,18,21) |
| InChIKey | QCGZHSCIROHUFJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |