C17H26N2O3 — CID 107239959
tert-butyl N-[3-[(1-cyclopropyl-2-methoxyethyl)amino]phenyl]carbamate (PubChem CID 107239959) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is tert-butyl N-[3-[(1-cyclopropyl-2-methoxyethyl)amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(1-cyclopropyl-2-methoxyethyl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 107239959 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | tert-butyl N-[3-[(1-cyclopropyl-2-methoxyethyl)amino]phenyl]carbamate |
| SMILES | COCC(Nc1cccc(NC(=O)OC(C)(C)C)c1)C1CC1 |
| InChI | InChI=1S/C17H26N2O3/c1-17(2,3)22-16(20)19-14-7-5-6-13(10-14)18-15(11-21-4)12-8-9-12/h5-7,10,12,15,18H,8-9,11H2,1-4H3,(H,19,20) |
| InChIKey | AHLWBQKDNWBWDW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |