C23H31N3O2 — CID 68960155
tert-butyl N-[3-[(1-benzylpiperidin-4-yl)amino]phenyl]carbamate (PubChem CID 68960155) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is tert-butyl N-[3-[(1-benzylpiperidin-4-yl)amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(1-benzylpiperidin-4-yl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 68960155 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | tert-butyl N-[3-[(1-benzylpiperidin-4-yl)amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(NC2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H31N3O2/c1-23(2,3)28-22(27)25-21-11-7-10-20(16-21)24-19-12-14-26(15-13-19)17-18-8-5-4-6-9-18/h4-11,16,19,24H,12-15,17H2,1-3H3,(H,25,27) |
| InChIKey | VUIJYGXNBPCVBN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |