C24H32FN3O2 — CID 59424374
tert-butyl N-[2-[[(1-benzylpiperidin-4-yl)amino]methyl]-6-fluorophenyl]carbamate (PubChem CID 59424374) has the molecular formula C24H32FN3O2 and a molecular weight of 413.54 g/mol. Its IUPAC name is tert-butyl N-[2-[[(1-benzylpiperidin-4-yl)amino]methyl]-6-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(1-benzylpiperidin-4-yl)amino]methyl]-6-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 59424374 |
| Molecular Formula | C24H32FN3O2 |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | tert-butyl N-[2-[[(1-benzylpiperidin-4-yl)amino]methyl]-6-fluorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1c(F)cccc1CNC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H32FN3O2/c1-24(2,3)30-23(29)27-22-19(10-7-11-21(22)25)16-26-20-12-14-28(15-13-20)17-18-8-5-4-6-9-18/h4-11,20,26H,12-17H2,1-3H3,(H,27,29) |
| InChIKey | AJFSYUBDVAIJPE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |