C17H27N3O2 — CID 107239561
tert-butyl N-[4-[[(3-aminocyclopentyl)amino]methyl]phenyl]carbamate (PubChem CID 107239561) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is tert-butyl N-[4-[[(3-aminocyclopentyl)amino]methyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[(3-aminocyclopentyl)amino]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 107239561 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | tert-butyl N-[4-[[(3-aminocyclopentyl)amino]methyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CNC2CCC(N)C2)cc1 |
| InChI | InChI=1S/C17H27N3O2/c1-17(2,3)22-16(21)20-14-7-4-12(5-8-14)11-19-15-9-6-13(18)10-15/h4-5,7-8,13,15,19H,6,9-11,18H2,1-3H3,(H,20,21) |
| InChIKey | RIRRQAUOYAUANN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |