C11H16N2 — CID 178138504
trans-(1R,3R)-3-N-phenylcyclopentane-1,3-diamine (PubChem CID 178138504) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is trans-(1R,3R)-3-N-phenylcyclopentane-1,3-diamine.
| Compound Name | trans-(1R,3R)-3-N-phenylcyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 178138504 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | trans-(1R,3R)-3-N-phenylcyclopentane-1,3-diamine |
| SMILES | N[C@@H]1CC[C@@H](Nc2ccccc2)C1 |
| InChI | InChI=1S/C11H16N2/c12-9-6-7-11(8-9)13-10-4-2-1-3-5-10/h1-5,9,11,13H,6-8,12H2/t9-,11-/m1/s1 |
| InChIKey | PYCBTVAQTFANDU-MWLCHTKSSA-N |
| XLogP | 1.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |