C12H18N2 — CID 79461968
3-N-(4-methylphenyl)cyclopentane-1,3-diamine (PubChem CID 79461968) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 3-N-(4-methylphenyl)cyclopentane-1,3-diamine.
| Compound Name | 3-N-(4-methylphenyl)cyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 79461968 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 3-N-(4-methylphenyl)cyclopentane-1,3-diamine |
| SMILES | Cc1ccc(NC2CCC(N)C2)cc1 |
| InChI | InChI=1S/C12H18N2/c1-9-2-5-11(6-3-9)14-12-7-4-10(13)8-12/h2-3,5-6,10,12,14H,4,7-8,13H2,1H3 |
| InChIKey | BQIFPAQUJOPMBK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |