C13H20N2 — CID 79461969
3-N-(2,5-dimethylphenyl)cyclopentane-1,3-diamine (PubChem CID 79461969) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 3-N-(2,5-dimethylphenyl)cyclopentane-1,3-diamine.
| Compound Name | 3-N-(2,5-dimethylphenyl)cyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 79461969 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 3-N-(2,5-dimethylphenyl)cyclopentane-1,3-diamine |
| SMILES | Cc1ccc(C)c(NC2CCC(N)C2)c1 |
| InChI | InChI=1S/C13H20N2/c1-9-3-4-10(2)13(7-9)15-12-6-5-11(14)8-12/h3-4,7,11-12,15H,5-6,8,14H2,1-2H3 |
| InChIKey | DYYZVRURHJDLHF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |