C12H17FN2 — CID 79462820
3-N-(3-fluoro-4-methylphenyl)cyclopentane-1,3-diamine (PubChem CID 79462820) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is 3-N-(3-fluoro-4-methylphenyl)cyclopentane-1,3-diamine.
| Compound Name | 3-N-(3-fluoro-4-methylphenyl)cyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 79462820 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 3-N-(3-fluoro-4-methylphenyl)cyclopentane-1,3-diamine |
| SMILES | Cc1ccc(NC2CCC(N)C2)cc1F |
| InChI | InChI=1S/C12H17FN2/c1-8-2-4-11(7-12(8)13)15-10-5-3-9(14)6-10/h2,4,7,9-10,15H,3,5-6,14H2,1H3 |
| InChIKey | PZAKIKNNKIVUNS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |