C12H16F2N2 — CID 82818304
3-N-(2,6-difluoro-3-methylphenyl)cyclopentane-1,3-diamine (PubChem CID 82818304) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is 3-N-(2,6-difluoro-3-methylphenyl)cyclopentane-1,3-diamine.
| Compound Name | 3-N-(2,6-difluoro-3-methylphenyl)cyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 82818304 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 3-N-(2,6-difluoro-3-methylphenyl)cyclopentane-1,3-diamine |
| SMILES | Cc1ccc(F)c(NC2CCC(N)C2)c1F |
| InChI | InChI=1S/C12H16F2N2/c1-7-2-5-10(13)12(11(7)14)16-9-4-3-8(15)6-9/h2,5,8-9,16H,3-4,6,15H2,1H3 |
| InChIKey | RAAKLRNIVWZQMW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |