C12H16F2N2 — CID 79458634
1-N-(2,6-difluorophenyl)cyclohexane-1,3-diamine (PubChem CID 79458634) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is 1-N-(2,6-difluorophenyl)cyclohexane-1,3-diamine.
| Compound Name | 1-N-(2,6-difluorophenyl)cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 79458634 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 1-N-(2,6-difluorophenyl)cyclohexane-1,3-diamine |
| SMILES | NC1CCCC(Nc2c(F)cccc2F)C1 |
| InChI | InChI=1S/C12H16F2N2/c13-10-5-2-6-11(14)12(10)16-9-4-1-3-8(15)7-9/h2,5-6,8-9,16H,1,3-4,7,15H2 |
| InChIKey | YAGXMYYDAWCUAL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |