C12H16BrFN2 — CID 79459495
1-N-(4-bromo-2-fluorophenyl)cyclohexane-1,3-diamine (PubChem CID 79459495) has the molecular formula C12H16BrFN2 and a molecular weight of 287.18 g/mol. Its IUPAC name is 1-N-(4-bromo-2-fluorophenyl)cyclohexane-1,3-diamine.
| Compound Name | 1-N-(4-bromo-2-fluorophenyl)cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 79459495 |
| Molecular Formula | C12H16BrFN2 |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 1-N-(4-bromo-2-fluorophenyl)cyclohexane-1,3-diamine |
| SMILES | NC1CCCC(Nc2ccc(Br)cc2F)C1 |
| InChI | InChI=1S/C12H16BrFN2/c13-8-4-5-12(11(14)6-8)16-10-3-1-2-9(15)7-10/h4-6,9-10,16H,1-3,7,15H2 |
| InChIKey | HBGFOSZERJZGHN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |