C12H15BrF2N2 — CID 79458131
1-N-(4-bromo-2,6-difluorophenyl)cyclohexane-1,3-diamine (PubChem CID 79458131) has the molecular formula C12H15BrF2N2 and a molecular weight of 305.17 g/mol. Its IUPAC name is 1-N-(4-bromo-2,6-difluorophenyl)cyclohexane-1,3-diamine.
| Compound Name | 1-N-(4-bromo-2,6-difluorophenyl)cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 79458131 |
| Molecular Formula | C12H15BrF2N2 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 1-N-(4-bromo-2,6-difluorophenyl)cyclohexane-1,3-diamine |
| SMILES | NC1CCCC(Nc2c(F)cc(Br)cc2F)C1 |
| InChI | InChI=1S/C12H15BrF2N2/c13-7-4-10(14)12(11(15)5-7)17-9-3-1-2-8(16)6-9/h4-5,8-9,17H,1-3,6,16H2 |
| InChIKey | KJEQUONJQYSARM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |