C13H19FN2 — CID 79459008
1-N-(3-fluoro-4-methylphenyl)cyclohexane-1,3-diamine (PubChem CID 79459008) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is 1-N-(3-fluoro-4-methylphenyl)cyclohexane-1,3-diamine.
| Compound Name | 1-N-(3-fluoro-4-methylphenyl)cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 79459008 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 1-N-(3-fluoro-4-methylphenyl)cyclohexane-1,3-diamine |
| SMILES | Cc1ccc(NC2CCCC(N)C2)cc1F |
| InChI | InChI=1S/C13H19FN2/c1-9-5-6-12(8-13(9)14)16-11-4-2-3-10(15)7-11/h5-6,8,10-11,16H,2-4,7,15H2,1H3 |
| InChIKey | FLCJKLSMLXYOAM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |