C12H16ClFN2 — CID 79459216
1-N-(2-chloro-4-fluorophenyl)cyclohexane-1,3-diamine (PubChem CID 79459216) has the molecular formula C12H16ClFN2 and a molecular weight of 242.72 g/mol. Its IUPAC name is 1-N-(2-chloro-4-fluorophenyl)cyclohexane-1,3-diamine.
| Compound Name | 1-N-(2-chloro-4-fluorophenyl)cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 79459216 |
| Molecular Formula | C12H16ClFN2 |
| Molecular Weight | 242.72 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-N-(2-chloro-4-fluorophenyl)cyclohexane-1,3-diamine |
| SMILES | NC1CCCC(Nc2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C12H16ClFN2/c13-11-6-8(14)4-5-12(11)16-10-3-1-2-9(15)7-10/h4-6,9-10,16H,1-3,7,15H2 |
| InChIKey | OSOHGJZRJHRFHB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.72 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |