C11H15BrN2 — CID 80560844
1-N-(5-bromo-2-methylphenyl)cyclobutane-1,3-diamine (PubChem CID 80560844) has the molecular formula C11H15BrN2 and a molecular weight of 255.16 g/mol. Its IUPAC name is 1-N-(5-bromo-2-methylphenyl)cyclobutane-1,3-diamine.
| Compound Name | 1-N-(5-bromo-2-methylphenyl)cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 80560844 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 1-N-(5-bromo-2-methylphenyl)cyclobutane-1,3-diamine |
| SMILES | Cc1ccc(Br)cc1NC1CC(N)C1 |
| InChI | InChI=1S/C11H15BrN2/c1-7-2-3-8(12)4-11(7)14-10-5-9(13)6-10/h2-4,9-10,14H,5-6,13H2,1H3 |
| InChIKey | QBWKKCPELCTWBA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |