C17H26BrN — CID 112681987
5-bromo-2-methyl-N-(3,3,5,5-tetramethylcyclohexyl)aniline (PubChem CID 112681987) has the molecular formula C17H26BrN and a molecular weight of 324.31 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-(3,3,5,5-tetramethylcyclohexyl)aniline.
| Compound Name | 5-bromo-2-methyl-N-(3,3,5,5-tetramethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 112681987 |
| Molecular Formula | C17H26BrN |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 5-bromo-2-methyl-N-(3,3,5,5-tetramethylcyclohexyl)aniline |
| SMILES | Cc1ccc(Br)cc1NC1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C17H26BrN/c1-12-6-7-13(18)8-15(12)19-14-9-16(2,3)11-17(4,5)10-14/h6-8,14,19H,9-11H2,1-5H3 |
| InChIKey | JJZICIUAVNRZQM-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |