About 5-bromo-N-(3,3-dimethylcyclopentyl)-2-methylaniline
5-bromo-N-(3,3-dimethylcyclopentyl)-2-methylaniline (PubChem CID 80705464) has the molecular formula C14H20BrN
and a molecular weight of 282.22 g/mol. Its IUPAC name is 5-bromo-N-(3,3-dimethylcyclopentyl)-2-methylaniline.
Molecular Properties
| Compound Name | 5-bromo-N-(3,3-dimethylcyclopentyl)-2-methylaniline |
| PubChem CID | 80705464 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 5-bromo-N-(3,3-dimethylcyclopentyl)-2-methylaniline |
| SMILES | Cc1ccc(Br)cc1NC1CCC(C)(C)C1 |
| InChI | InChI=1S/C14H20BrN/c1-10-4-5-11(15)8-13(10)16-12-6-7-14(2,3)9-12/h4-5,8,12,16H,6-7,9H2,1-3H3 |
| InChIKey | ININHIMEOAYTLQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-bromo-N-(3,3-dimethylcyclopentyl)-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(3,3-dimethylcyclopentyl)-2-methylaniline?
The IUPAC name of 5-bromo-N-(3,3-dimethylcyclopentyl)-2-methylaniline (CID 80705464) is 5-bromo-N-(3,3-dimethylcyclopentyl)-2-methylaniline.
What is the SMILES notation for 5-bromo-N-(3,3-dimethylcyclopentyl)-2-methylaniline?
The canonical SMILES for 5-bromo-N-(3,3-dimethylcyclopentyl)-2-methylaniline is Cc1ccc(Br)cc1NC1CCC(C)(C)C1.
What is the InChIKey of 5-bromo-N-(3,3-dimethylcyclopentyl)-2-methylaniline?
The InChIKey is ININHIMEOAYTLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20BrN/c1-10-4-5-11(15)8-13(10)16-12-6-7-14(2,3)9-12/h4-5,8,12,16H,6-7,9H2,1-3H3.
What are the key properties of 5-bromo-N-(3,3-dimethylcyclopentyl)-2-methylaniline?
5-bromo-N-(3,3-dimethylcyclopentyl)-2-methylaniline has a molecular weight of 282.22 g/mol, XLogP of 4.75, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(3,3-dimethylcyclopentyl)-2-methylaniline is sourced from PubChem (CID 80705464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).