C14H19ClN2OS — CID 107131586
2-chloro-N,N-dimethyl-5-(thiolan-3-ylmethylamino)benzamide (PubChem CID 107131586) has the molecular formula C14H19ClN2OS and a molecular weight of 298.84 g/mol. Its IUPAC name is 2-chloro-N,N-dimethyl-5-(thiolan-3-ylmethylamino)benzamide.
| Compound Name | 2-chloro-N,N-dimethyl-5-(thiolan-3-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 107131586 |
| Molecular Formula | C14H19ClN2OS |
| Molecular Weight | 298.84 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-chloro-N,N-dimethyl-5-(thiolan-3-ylmethylamino)benzamide |
| SMILES | CN(C)C(=O)c1cc(NCC2CCSC2)ccc1Cl |
| InChI | InChI=1S/C14H19ClN2OS/c1-17(2)14(18)12-7-11(3-4-13(12)15)16-8-10-5-6-19-9-10/h3-4,7,10,16H,5-6,8-9H2,1-2H3 |
| InChIKey | GMNJUAXMTPKGOD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.84 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |