C14H18F3NS — CID 79952289
4,4-dimethyl-N-[4-(trifluoromethyl)phenyl]thian-3-amine (PubChem CID 79952289) has the molecular formula C14H18F3NS and a molecular weight of 289.37 g/mol. Its IUPAC name is 4,4-dimethyl-N-[4-(trifluoromethyl)phenyl]thian-3-amine.
| Compound Name | 4,4-dimethyl-N-[4-(trifluoromethyl)phenyl]thian-3-amine |
|---|---|
| PubChem CID | 79952289 |
| Molecular Formula | C14H18F3NS |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4,4-dimethyl-N-[4-(trifluoromethyl)phenyl]thian-3-amine |
| SMILES | CC1(C)CCSCC1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H18F3NS/c1-13(2)7-8-19-9-12(13)18-11-5-3-10(4-6-11)14(15,16)17/h3-6,12,18H,7-9H2,1-2H3 |
| InChIKey | GRQYSBXLERCANY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |