C13H16Cl2FNS — CID 83076961
N-(2,6-dichloro-4-fluorophenyl)-4,4-dimethylthian-3-amine (PubChem CID 83076961) has the molecular formula C13H16Cl2FNS and a molecular weight of 308.25 g/mol. Its IUPAC name is N-(2,6-dichloro-4-fluorophenyl)-4,4-dimethylthian-3-amine.
| Compound Name | N-(2,6-dichloro-4-fluorophenyl)-4,4-dimethylthian-3-amine |
|---|---|
| PubChem CID | 83076961 |
| Molecular Formula | C13H16Cl2FNS |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | N-(2,6-dichloro-4-fluorophenyl)-4,4-dimethylthian-3-amine |
| SMILES | CC1(C)CCSCC1Nc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C13H16Cl2FNS/c1-13(2)3-4-18-7-11(13)17-12-9(14)5-8(16)6-10(12)15/h5-6,11,17H,3-4,7H2,1-2H3 |
| InChIKey | BHNNHIMEWJUQAM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |