C14H19F2NS — CID 79949049
N-[(2,4-difluorophenyl)methyl]-4,4-dimethylthian-3-amine (PubChem CID 79949049) has the molecular formula C14H19F2NS and a molecular weight of 271.38 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-4,4-dimethylthian-3-amine.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-4,4-dimethylthian-3-amine |
|---|---|
| PubChem CID | 79949049 |
| Molecular Formula | C14H19F2NS |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-4,4-dimethylthian-3-amine |
| SMILES | CC1(C)CCSCC1NCc1ccc(F)cc1F |
| InChI | InChI=1S/C14H19F2NS/c1-14(2)5-6-18-9-13(14)17-8-10-3-4-11(15)7-12(10)16/h3-4,7,13,17H,5-6,8-9H2,1-2H3 |
| InChIKey | MHLWFJIJZRHXFK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |